C35H52O5 — CID 162818041
(1R,5R,7R,8S)-4-hydroxy-5-[(E)-4-hydroxy-3-methylbut-2-enyl]-8-methyl-3,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 162818041) has the molecular formula C35H52O5 and a molecular weight of 552.80 g/mol. Its IUPAC name is (1R,5R,7R,8S)-4-hydroxy-5-[(E)-4-hydroxy-3-methylbut-2-enyl]-8-methyl-3,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1R,5R,7R,8S)-4-hydroxy-5-[(E)-4-hydroxy-3-methylbut-2-enyl]-8-methyl-3,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 162818041 |
| Molecular Formula | C35H52O5 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (1R,5R,7R,8S)-4-hydroxy-5-[(E)-4-hydroxy-3-methylbut-2-enyl]-8-methyl-3,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC(C)=CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@@]2(C/C=C(\C)CO)C(=O)[C@]1(C(=O)C(C)C)C(=O)C(CC=C(C)C)=C2O |
| InChI | InChI=1S/C35H52O5/c1-22(2)12-11-18-33(10)27(15-13-23(3)4)20-34(19-17-26(9)21-36)30(38)28(16-14-24(5)6)31(39)35(33,32(34)40)29(37)25(7)8/h12-14,17,25,27,36,38H,11,15-16,18-21H2,1-10H3/b26-17+/t27-,33+,34-,35+/m1/s1 |
| InChIKey | SBJDKVGRDHIBSA-VIODULMBSA-N |
| XLogP | 7.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|