C34H48O4 — CID 101173146
(1S,3S,8R,9R,10S)-9-methyl-6,9,10-tris(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 101173146) has the molecular formula C34H48O4 and a molecular weight of 520.75 g/mol. Its IUPAC name is (1S,3S,8R,9R,10S)-9-methyl-6,9,10-tris(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,3S,8R,9R,10S)-9-methyl-6,9,10-tris(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 101173146 |
| Molecular Formula | C34H48O4 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (1S,3S,8R,9R,10S)-9-methyl-6,9,10-tris(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | C=C(C)[C@@H]1C[C@@]23C[C@H](CC=C(C)C)[C@@](C)(CC=C(C)C)[C@@](C(=O)C(C)C)(C(=O)C(CC=C(C)C)=C2O1)C3=O |
| InChI | InChI=1S/C34H48O4/c1-20(2)12-14-25-18-33-19-27(23(7)8)38-30(33)26(15-13-21(3)4)29(36)34(31(33)37,28(35)24(9)10)32(25,11)17-16-22(5)6/h12-13,16,24-25,27H,7,14-15,17-19H2,1-6,8-11H3/t25-,27-,32+,33-,34-/m0/s1 |
| InChIKey | HXAMISPJWMALQL-YGWKPFRVSA-N |
| XLogP | 8.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|