C35H50O4 — CID 11135275
(1S,3S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 11135275) has the molecular formula C35H50O4 and a molecular weight of 534.78 g/mol. Its IUPAC name is (1S,3S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,3S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 11135275 |
| Molecular Formula | C35H50O4 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | (1S,3S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | C=C(C)[C@@H]1C[C@@]23C[C@H](CC=C(C)C)[C@@](C)(CCC=C(C)C)[C@@](C(=O)C(C)C)(C(=O)C(CC=C(C)C)=C2O1)C3=O |
| InChI | InChI=1S/C35H50O4/c1-21(2)13-12-18-33(11)26(16-14-22(3)4)19-34-20-28(24(7)8)39-31(34)27(17-15-23(5)6)30(37)35(33,32(34)38)29(36)25(9)10/h13-15,25-26,28H,7,12,16-20H2,1-6,8-11H3/t26-,28-,33+,34-,35-/m0/s1 |
| InChIKey | IRBFXLQUMXYTSL-FYTLJFFJSA-N |
| XLogP | 8.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|