C30H48O8 — CID 85418752
3,6,7-trihydroxy-7-(3-hydroxy-3-methylbutyl)-4,4,10,10-tetramethyl-11-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-5-oxatricyclo[7.3.1.01,6]tridecane-8,13-dione (PubChem CID 85418752) has the molecular formula C30H48O8 and a molecular weight of 536.71 g/mol. Its IUPAC name is 3,6,7-trihydroxy-7-(3-hydroxy-3-methylbutyl)-4,4,10,10-tetramethyl-11-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-5-oxatricyclo[7.3.1.01,6]tridecane-8,13-dione.
| Compound Name | 3,6,7-trihydroxy-7-(3-hydroxy-3-methylbutyl)-4,4,10,10-tetramethyl-11-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-5-oxatricyclo[7.3.1.01,6]tridecane-8,13-dione |
|---|---|
| PubChem CID | 85418752 |
| Molecular Formula | C30H48O8 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 3,6,7-trihydroxy-7-(3-hydroxy-3-methylbutyl)-4,4,10,10-tetramethyl-11-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-5-oxatricyclo[7.3.1.01,6]tridecane-8,13-dione |
| SMILES | CC(C)=CCC1CC23CC(O)C(C)(C)OC2(O)C(O)(CCC(C)(C)O)C(=O)C(C(=O)C(C)C)(C3=O)C1(C)C |
| InChI | InChI=1S/C30H48O8/c1-17(2)11-12-19-15-27-16-20(31)26(9,10)38-30(27,37)28(36,14-13-24(5,6)35)23(34)29(22(27)33,25(19,7)8)21(32)18(3)4/h11,18-20,31,35-37H,12-16H2,1-10H3 |
| InChIKey | OPSLSPKQOYWANA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|