C25H38O6 — CID 11640632
(1S,3S,8R,10S)-10-(3-hydroxy-3-methylbutyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 11640632) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (1S,3S,8R,10S)-10-(3-hydroxy-3-methylbutyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,3S,8R,10S)-10-(3-hydroxy-3-methylbutyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 11640632 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (1S,3S,8R,10S)-10-(3-hydroxy-3-methylbutyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)C(=O)[C@@]12C(=O)C=C3O[C@H](C(C)(C)O)C[C@]3(C[C@H](CCC(C)(C)O)C1(C)C)C2=O |
| InChI | InChI=1S/C25H38O6/c1-14(2)19(27)25-16(26)11-17-24(20(25)28,13-18(31-17)23(7,8)30)12-15(22(25,5)6)9-10-21(3,4)29/h11,14-15,18,29-30H,9-10,12-13H2,1-8H3/t15-,18-,24-,25+/m0/s1 |
| InChIKey | VXKQVLVRJUCFHR-YELKHUEOSA-N |
| XLogP | 3.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|