C33H44O5 — CID 163104219
1-benzoyl-4-(2-hydroxypropan-2-yl)-11,11-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-oxatricyclo[6.3.1.02,6]dodecane-7,12-dione (PubChem CID 163104219) has the molecular formula C33H44O5 and a molecular weight of 520.71 g/mol. Its IUPAC name is 1-benzoyl-4-(2-hydroxypropan-2-yl)-11,11-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-oxatricyclo[6.3.1.02,6]dodecane-7,12-dione.
| Compound Name | 1-benzoyl-4-(2-hydroxypropan-2-yl)-11,11-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-oxatricyclo[6.3.1.02,6]dodecane-7,12-dione |
|---|---|
| PubChem CID | 163104219 |
| Molecular Formula | C33H44O5 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 1-benzoyl-4-(2-hydroxypropan-2-yl)-11,11-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-oxatricyclo[6.3.1.02,6]dodecane-7,12-dione |
| SMILES | CC(C)=CCC1CC2(CC=C(C)C)C(=O)C3CC(C(C)(C)O)OC3C(C(=O)c3ccccc3)(C2=O)C1(C)C |
| InChI | InChI=1S/C33H44O5/c1-20(2)14-15-23-19-32(17-16-21(3)4)27(35)24-18-25(31(7,8)37)38-28(24)33(29(32)36,30(23,5)6)26(34)22-12-10-9-11-13-22/h9-14,16,23-25,28,37H,15,17-19H2,1-8H3 |
| InChIKey | GZWCJSLMGNUPFP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|