C38H50O5 — CID 162860764
(1S,3R,4R,6S,8R)-8-benzoyl-1-(3,7-dimethylocta-2,6-dienyl)-4-(2-hydroxypropan-2-yl)-7,7-dimethyl-3-(3-methylbut-2-enyl)tricyclo[4.3.1.13,8]undecane-2,9,11-trione (PubChem CID 162860764) has the molecular formula C38H50O5 and a molecular weight of 586.81 g/mol. Its IUPAC name is (1S,3R,4R,6S,8R)-8-benzoyl-1-(3,7-dimethylocta-2,6-dienyl)-4-(2-hydroxypropan-2-yl)-7,7-dimethyl-3-(3-methylbut-2-enyl)tricyclo[4.3.1.13,8]undecane-2,9,11-trione.
| Compound Name | (1S,3R,4R,6S,8R)-8-benzoyl-1-(3,7-dimethylocta-2,6-dienyl)-4-(2-hydroxypropan-2-yl)-7,7-dimethyl-3-(3-methylbut-2-enyl)tricyclo[4.3.1.13,8]undecane-2,9,11-trione |
|---|---|
| PubChem CID | 162860764 |
| Molecular Formula | C38H50O5 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | (1S,3R,4R,6S,8R)-8-benzoyl-1-(3,7-dimethylocta-2,6-dienyl)-4-(2-hydroxypropan-2-yl)-7,7-dimethyl-3-(3-methylbut-2-enyl)tricyclo[4.3.1.13,8]undecane-2,9,11-trione |
| SMILES | CC(C)=CCCC(C)=CC[C@]12C[C@@H]3C[C@@H](C(C)(C)O)[C@](CC=C(C)C)(C1=O)C(=O)[C@](C(=O)c1ccccc1)(C2=O)C3(C)C |
| InChI | InChI=1S/C38H50O5/c1-24(2)14-13-15-26(5)19-20-36-23-28-22-29(35(8,9)43)37(31(36)40,21-18-25(3)4)33(42)38(32(36)41,34(28,6)7)30(39)27-16-11-10-12-17-27/h10-12,14,16-19,28-29,43H,13,15,20-23H2,1-9H3/t28-,29-,36-,37+,38-/m0/s1 |
| InChIKey | GGXZVCSJJZPQKC-ZDXXRYHQSA-N |
| XLogP | 7.83 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|