C33H54O5Si — CID 101391319
(1R,3R,8S,10R)-8-(1-hydroxy-2-methylpropyl)-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-3-(2-trimethylsilyloxypropan-2-yl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 101391319) has the molecular formula C33H54O5Si and a molecular weight of 558.88 g/mol. Its IUPAC name is (1R,3R,8S,10R)-8-(1-hydroxy-2-methylpropyl)-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-3-(2-trimethylsilyloxypropan-2-yl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1R,3R,8S,10R)-8-(1-hydroxy-2-methylpropyl)-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-3-(2-trimethylsilyloxypropan-2-yl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 101391319 |
| Molecular Formula | C33H54O5Si |
| Molecular Weight | 558.88 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | (1R,3R,8S,10R)-8-(1-hydroxy-2-methylpropyl)-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-3-(2-trimethylsilyloxypropan-2-yl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)=CCC1=C2O[C@@H](C(C)(C)O[Si](C)(C)C)C[C@]23C[C@@H](CC=C(C)C)C(C)(C)[C@](C(O)C(C)C)(C1=O)C3=O |
| InChI | InChI=1S/C33H54O5Si/c1-20(2)14-16-23-18-32-19-25(31(9,10)38-39(11,12)13)37-28(32)24(17-15-21(3)4)27(35)33(29(32)36,30(23,7)8)26(34)22(5)6/h14-15,22-23,25-26,34H,16-19H2,1-13H3/t23-,25-,26?,32-,33-/m1/s1 |
| InChIKey | ORASZPXWORXKAZ-YWJCICOZSA-N |
| XLogP | 7.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.88 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|