C33H44O4 — CID 163192559
4-hydroxy-8-[hydroxy(phenyl)methylidene]-4-methyl-1,3,6-tris(3-methylbut-2-enyl)bicyclo[4.3.1]decane-7,10-dione (PubChem CID 163192559) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is 4-hydroxy-8-[hydroxy(phenyl)methylidene]-4-methyl-1,3,6-tris(3-methylbut-2-enyl)bicyclo[4.3.1]decane-7,10-dione.
| Compound Name | 4-hydroxy-8-[hydroxy(phenyl)methylidene]-4-methyl-1,3,6-tris(3-methylbut-2-enyl)bicyclo[4.3.1]decane-7,10-dione |
|---|---|
| PubChem CID | 163192559 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | 4-hydroxy-8-[hydroxy(phenyl)methylidene]-4-methyl-1,3,6-tris(3-methylbut-2-enyl)bicyclo[4.3.1]decane-7,10-dione |
| SMILES | CC(C)=CCC1CC2(CC=C(C)C)CC(=C(O)c3ccccc3)C(=O)C(CC=C(C)C)(CC1(C)O)C2=O |
| InChI | InChI=1S/C33H44O4/c1-22(2)13-14-26-19-32(17-15-23(3)4)20-27(28(34)25-11-9-8-10-12-25)29(35)33(30(32)36,18-16-24(5)6)21-31(26,7)37/h8-13,15-16,26,34,37H,14,17-21H2,1-7H3 |
| InChIKey | NJYJWUQFVIEYHG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|