C20H30O2 — CID 15241248
3-[(1S,2S,6S)-1-methyl-3-methylidene-2-[(2E)-3-methylpenta-2,4-dienyl]-6-prop-1-en-2-ylcyclohexyl]propanoic acid (PubChem CID 15241248) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-[(1S,2S,6S)-1-methyl-3-methylidene-2-[(2E)-3-methylpenta-2,4-dienyl]-6-prop-1-en-2-ylcyclohexyl]propanoic acid.
| Compound Name | 3-[(1S,2S,6S)-1-methyl-3-methylidene-2-[(2E)-3-methylpenta-2,4-dienyl]-6-prop-1-en-2-ylcyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 15241248 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3-[(1S,2S,6S)-1-methyl-3-methylidene-2-[(2E)-3-methylpenta-2,4-dienyl]-6-prop-1-en-2-ylcyclohexyl]propanoic acid |
| SMILES | C=C/C(C)=C/C[C@H]1C(=C)CC[C@@H](C(=C)C)[C@]1(C)CCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-7-15(4)8-10-18-16(5)9-11-17(14(2)3)20(18,6)13-12-19(21)22/h7-8,17-18H,1-2,5,9-13H2,3-4,6H3,(H,21,22)/b15-8+/t17-,18-,20-/m0/s1 |
| InChIKey | IOAMLRWLTANBPN-CENOODMHSA-N |
| XLogP | 5.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|