C20H25NO3 — CID 14261756
7-methoxy-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione (PubChem CID 14261756) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 7-methoxy-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione.
| Compound Name | 7-methoxy-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 14261756 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 7-methoxy-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione |
| SMILES | COc1ccc2c(c1)NC(=O)C(CC=C(C)C)(CC=C(C)C)C2=O |
| InChI | InChI=1S/C20H25NO3/c1-13(2)8-10-20(11-9-14(3)4)18(22)16-7-6-15(24-5)12-17(16)21-19(20)23/h6-9,12H,10-11H2,1-5H3,(H,21,23) |
| InChIKey | KCEMACKKFCZVND-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|