C12H12N4O3 — CID 2785624
3-azido-3-ethyl-7-methoxy-1H-quinoline-2,4-dione (PubChem CID 2785624) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-azido-3-ethyl-7-methoxy-1H-quinoline-2,4-dione.
| Compound Name | 3-azido-3-ethyl-7-methoxy-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 2785624 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-azido-3-ethyl-7-methoxy-1H-quinoline-2,4-dione |
| SMILES | CCC1(N=[N+]=[N-])C(=O)Nc2cc(OC)ccc2C1=O |
| InChI | InChI=1S/C12H12N4O3/c1-3-12(15-16-13)10(17)8-5-4-7(19-2)6-9(8)14-11(12)18/h4-6H,3H2,1-2H3,(H,14,18) |
| InChIKey | UBTMWJPMKTYFNR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|