About 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one
7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one (PubChem CID 82278075) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one.
Molecular Properties
| Compound Name | 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one |
| PubChem CID | 82278075 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one |
| SMILES | COc1ccc2c(c1)NCC1(CC1)C2=O |
| InChI | InChI=1S/C12H13NO2/c1-15-8-2-3-9-10(6-8)13-7-12(4-5-12)11(9)14/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | DBQXZJIUPXWEJE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one?
The IUPAC name of 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one (CID 82278075) is 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one.
What is the SMILES notation for 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one?
The canonical SMILES for 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one is COc1ccc2c(c1)NCC1(CC1)C2=O.
What is the InChIKey of 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one?
The InChIKey is DBQXZJIUPXWEJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-15-8-2-3-9-10(6-8)13-7-12(4-5-12)11(9)14/h2-3,6,13H,4-5,7H2,1H3.
What are the key properties of 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one?
7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one has a molecular weight of 203.24 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyspiro[1,2-dihydroquinoline-3,1'-cyclopropane]-4-one is sourced from PubChem (CID 82278075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).