C12H12O3 — CID 82277925
7-methoxyspiro[2H-chromene-3,1'-cyclopropane]-4-one (PubChem CID 82277925) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 7-methoxyspiro[2H-chromene-3,1'-cyclopropane]-4-one.
| Compound Name | 7-methoxyspiro[2H-chromene-3,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 82277925 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 7-methoxyspiro[2H-chromene-3,1'-cyclopropane]-4-one |
| SMILES | COc1ccc2c(c1)OCC1(CC1)C2=O |
| InChI | InChI=1S/C12H12O3/c1-14-8-2-3-9-10(6-8)15-7-12(4-5-12)11(9)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | QPWAIXMBYPGQFT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |