C16H22O4 — CID 101115257
(3R)-3-(hydroxymethyl)-7-methoxy-3-pentyl-2H-chromen-4-one (PubChem CID 101115257) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-7-methoxy-3-pentyl-2H-chromen-4-one.
| Compound Name | (3R)-3-(hydroxymethyl)-7-methoxy-3-pentyl-2H-chromen-4-one |
|---|---|
| PubChem CID | 101115257 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-7-methoxy-3-pentyl-2H-chromen-4-one |
| SMILES | CCCCC[C@@]1(CO)COc2cc(OC)ccc2C1=O |
| InChI | InChI=1S/C16H22O4/c1-3-4-5-8-16(10-17)11-20-14-9-12(19-2)6-7-13(14)15(16)18/h6-7,9,17H,3-5,8,10-11H2,1-2H3/t16-/m1/s1 |
| InChIKey | OXEQSAYNSTZDHC-MRXNPFEDSA-N |
| XLogP | 2.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|