C21H28O3 — CID 11566108
(E)-1-(8-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)oct-1-en-3-one (PubChem CID 11566108) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (E)-1-(8-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)oct-1-en-3-one.
| Compound Name | (E)-1-(8-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)oct-1-en-3-one |
|---|---|
| PubChem CID | 11566108 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (E)-1-(8-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)oct-1-en-3-one |
| SMILES | CCCCCC(=O)/C=C/C1=CC(C)(C)COc2cc(OC)ccc21 |
| InChI | InChI=1S/C21H28O3/c1-5-6-7-8-17(22)10-9-16-14-21(2,3)15-24-20-13-18(23-4)11-12-19(16)20/h9-14H,5-8,15H2,1-4H3/b10-9+ |
| InChIKey | IJJAVLWFIVOYFX-MDZDMXLPSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|