About (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one
(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 7000123) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
Analyze (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one?
The IUPAC name of (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CID 7000123) is (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
What is the SMILES notation for (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one?
The canonical SMILES for (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one is C[C@@]12CCCCC1=CC(=O)CC2.
What is the InChIKey of (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one?
The InChIKey is OHERZLWVBJCXOF-NSHDSACASA-N. The full InChI is InChI=1S/C11H16O/c1-11-6-3-2-4-9(11)8-10(12)5-7-11/h8H,2-7H2,1H3/t11-/m0/s1.
What are the key properties of (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one?
(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one has a molecular weight of 164.25 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one is sourced from PubChem (CID 7000123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).