C10H14O — CID 22216641
(7aS)-7a-methyl-4,5,6,7-tetrahydro-1H-inden-2-one (PubChem CID 22216641) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (7aS)-7a-methyl-4,5,6,7-tetrahydro-1H-inden-2-one.
| Compound Name | (7aS)-7a-methyl-4,5,6,7-tetrahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 22216641 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (7aS)-7a-methyl-4,5,6,7-tetrahydro-1H-inden-2-one |
| SMILES | C[C@@]12CCCCC1=CC(=O)C2 |
| InChI | InChI=1S/C10H14O/c1-10-5-3-2-4-8(10)6-9(11)7-10/h6H,2-5,7H2,1H3/t10-/m0/s1 |
| InChIKey | HJDKCIOQDUHLEF-JTQLQIEISA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |