C13H22N2 — CID 11264232
N-[(E)-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]amino]-N-methylmethanamine (PubChem CID 11264232) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[(E)-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 11264232 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[(E)-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]amino]-N-methylmethanamine |
| SMILES | CN(C)/N=C1/C=C2CCCC[C@@]2(C)CC1 |
| InChI | InChI=1S/C13H22N2/c1-13-8-5-4-6-11(13)10-12(7-9-13)14-15(2)3/h10H,4-9H2,1-3H3/b14-12+/t13-/m0/s1 |
| InChIKey | NIRXBTHOGKELNL-REQDGWNSSA-N |
| XLogP | 3.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|