C11H18O — CID 130741530
(4aR)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol (PubChem CID 130741530) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4aR)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (4aR)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 130741530 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4aR)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
| SMILES | C[C@]12CCCCC1=CC(O)CC2 |
| InChI | InChI=1S/C11H18O/c1-11-6-3-2-4-9(11)8-10(12)5-7-11/h8,10,12H,2-7H2,1H3/t10?,11-/m1/s1 |
| InChIKey | ZRALQUNYQUFRDO-RRKGBCIJSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|