C13H22O — CID 11458235
(2S,4aS)-4a,8,8-trimethyl-2,3,4,5,6,7-hexahydronaphthalen-2-ol (PubChem CID 11458235) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2S,4aS)-4a,8,8-trimethyl-2,3,4,5,6,7-hexahydronaphthalen-2-ol.
| Compound Name | (2S,4aS)-4a,8,8-trimethyl-2,3,4,5,6,7-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 11458235 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2S,4aS)-4a,8,8-trimethyl-2,3,4,5,6,7-hexahydronaphthalen-2-ol |
| SMILES | CC1(C)CCC[C@@]2(C)CC[C@H](O)C=C12 |
| InChI | InChI=1S/C13H22O/c1-12(2)6-4-7-13(3)8-5-10(14)9-11(12)13/h9-10,14H,4-8H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | LBWYEHJYSKGFCW-GWCFXTLKSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|