C20H28O4 — CID 162936555
(1S,4aS,8aR)-1-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]ethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde (PubChem CID 162936555) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,4aS,8aR)-1-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]ethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde.
| Compound Name | (1S,4aS,8aR)-1-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]ethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 162936555 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,4aS,8aR)-1-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]ethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H](CCC3=CC(=O)O[C@@H]3O)C(C=O)=CC[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-19(2)9-4-10-20(3)15(14(12-21)6-8-16(19)20)7-5-13-11-17(22)24-18(13)23/h6,11-12,15-16,18,23H,4-5,7-10H2,1-3H3/t15-,16+,18+,20+/m1/s1 |
| InChIKey | NSPMBWKQIHHDLF-JMVFIXPQSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|