C24H34O6 — CID 101189712
[3-[(1S)-2-[(1R,4aR,8aR)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-acetyloxyethyl]-5-oxo-2H-furan-2-yl] acetate (PubChem CID 101189712) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [3-[(1S)-2-[(1R,4aR,8aR)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-acetyloxyethyl]-5-oxo-2H-furan-2-yl] acetate.
| Compound Name | [3-[(1S)-2-[(1R,4aR,8aR)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-acetyloxyethyl]-5-oxo-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 101189712 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [3-[(1S)-2-[(1R,4aR,8aR)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-acetyloxyethyl]-5-oxo-2H-furan-2-yl] acetate |
| SMILES | CC(=O)OC1OC(=O)C=C1[C@H](C[C@@H]1C(C)=CC[C@@H]2C(C)(C)CCC[C@@]12C)OC(C)=O |
| InChI | InChI=1S/C24H34O6/c1-14-8-9-20-23(4,5)10-7-11-24(20,6)18(14)13-19(28-15(2)25)17-12-21(27)30-22(17)29-16(3)26/h8,12,18-20,22H,7,9-11,13H2,1-6H3/t18-,19+,20-,22?,24+/m1/s1 |
| InChIKey | NZYZEWIAHFVZSA-GCWFWYKCSA-N |
| XLogP | 4.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|