C22H32O3 — CID 10947933
[(1S)-2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-(furan-3-yl)ethyl] acetate (PubChem CID 10947933) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1S)-2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-(furan-3-yl)ethyl] acetate.
| Compound Name | [(1S)-2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-(furan-3-yl)ethyl] acetate |
|---|---|
| PubChem CID | 10947933 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1S)-2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1-(furan-3-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@H]1C(C)=CC[C@H]2C(C)(C)CCC[C@]12C)c1ccoc1 |
| InChI | InChI=1S/C22H32O3/c1-15-7-8-20-21(3,4)10-6-11-22(20,5)18(15)13-19(25-16(2)23)17-9-12-24-14-17/h7,9,12,14,18-20H,6,8,10-11,13H2,1-5H3/t18-,19-,20-,22+/m0/s1 |
| InChIKey | JQPHEXBZJLFBIP-BPBCIEFSSA-N |
| XLogP | 6.07 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|