C27H40O4 — CID 15119527
[(1S)-2-[(2S,3S,3aR,5aS,9aS,9bR)-2-formyl-2,3a,6,6,9a-pentamethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-(furan-3-yl)ethyl] acetate (PubChem CID 15119527) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(1S)-2-[(2S,3S,3aR,5aS,9aS,9bR)-2-formyl-2,3a,6,6,9a-pentamethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-(furan-3-yl)ethyl] acetate.
| Compound Name | [(1S)-2-[(2S,3S,3aR,5aS,9aS,9bR)-2-formyl-2,3a,6,6,9a-pentamethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-(furan-3-yl)ethyl] acetate |
|---|---|
| PubChem CID | 15119527 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [(1S)-2-[(2S,3S,3aR,5aS,9aS,9bR)-2-formyl-2,3a,6,6,9a-pentamethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-(furan-3-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@H]1[C@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2C[C@]1(C)C=O)c1ccoc1 |
| InChI | InChI=1S/C27H40O4/c1-18(29)31-20(19-9-13-30-16-19)14-22-25(4,17-28)15-23-26(5)11-7-10-24(2,3)21(26)8-12-27(22,23)6/h9,13,16-17,20-23H,7-8,10-12,14-15H2,1-6H3/t20-,21-,22+,23+,25+,26-,27-/m0/s1 |
| InChIKey | ICLMNNHOIMGCQA-OSUFMNBKSA-N |
| XLogP | 6.75 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|