C25H38O5S — CID 21148855
[(E)-[(4aR,4bS,8aS,10aR)-1-[2-(furan-3-yl)ethyl]-4b,8,8,10a-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl] hydrogen sulfate (PubChem CID 21148855) has the molecular formula C25H38O5S and a molecular weight of 450.64 g/mol. Its IUPAC name is [(E)-[(4aR,4bS,8aS,10aR)-1-[2-(furan-3-yl)ethyl]-4b,8,8,10a-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl] hydrogen sulfate.
| Compound Name | [(E)-[(4aR,4bS,8aS,10aR)-1-[2-(furan-3-yl)ethyl]-4b,8,8,10a-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl] hydrogen sulfate |
|---|---|
| PubChem CID | 21148855 |
| Molecular Formula | C25H38O5S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [(E)-[(4aR,4bS,8aS,10aR)-1-[2-(furan-3-yl)ethyl]-4b,8,8,10a-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl] hydrogen sulfate |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC/C(=C\OS(=O)(=O)O)C(CCc4ccoc4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H38O5S/c1-23(2)12-5-13-25(4)21(23)10-14-24(3)20(8-6-18-11-15-29-16-18)19(7-9-22(24)25)17-30-31(26,27)28/h11,15-17,20-22H,5-10,12-14H2,1-4H3,(H,26,27,28)/b19-17+/t20?,21-,22-,24-,25-/m0/s1 |
| InChIKey | WGQUKTHZSJRQFE-YICPYXILSA-N |
| XLogP | 6.57 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|