C24H37NO2 — CID 122195549
(1S,4aS,5R,8aS)-N,N-diethyl-5-[2-(furan-3-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide (PubChem CID 122195549) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (1S,4aS,5R,8aS)-N,N-diethyl-5-[2-(furan-3-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide.
| Compound Name | (1S,4aS,5R,8aS)-N,N-diethyl-5-[2-(furan-3-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 122195549 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (1S,4aS,5R,8aS)-N,N-diethyl-5-[2-(furan-3-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
| SMILES | C=C1CC[C@H]2[C@@](C)(CCC[C@]2(C)C(=O)N(CC)CC)[C@@H]1CCc1ccoc1 |
| InChI | InChI=1S/C24H37NO2/c1-6-25(7-2)22(26)24(5)15-8-14-23(4)20(18(3)9-12-21(23)24)11-10-19-13-16-27-17-19/h13,16-17,20-21H,3,6-12,14-15H2,1-2,4-5H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | CNFAGGMXCAOFLL-KJBBBAAKSA-N |
| XLogP | 5.86 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|