C19H28O3 — CID 12011179
(4R,4aR,8R,8aR)-4-[2-(furan-3-yl)ethyl]-8-(hydroxymethyl)-8-methyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-ol (PubChem CID 12011179) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4R,4aR,8R,8aR)-4-[2-(furan-3-yl)ethyl]-8-(hydroxymethyl)-8-methyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (4R,4aR,8R,8aR)-4-[2-(furan-3-yl)ethyl]-8-(hydroxymethyl)-8-methyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 12011179 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (4R,4aR,8R,8aR)-4-[2-(furan-3-yl)ethyl]-8-(hydroxymethyl)-8-methyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-ol |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)CCC[C@@]2(O)[C@@H]1CCc1ccoc1 |
| InChI | InChI=1S/C19H28O3/c1-14-4-7-17-18(2,13-20)9-3-10-19(17,21)16(14)6-5-15-8-11-22-12-15/h8,11-12,16-17,20-21H,1,3-7,9-10,13H2,2H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | GHWVPMFSXMFAIQ-AKHDSKFASA-N |
| XLogP | 3.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|