C20H26O4 — CID 52939469
(1R,3R,4R,8R,9R,14S)-4-[2-(furan-3-yl)ethyl]-3-methyl-5-methylidene-11,13,15-trioxatetracyclo[10.2.1.03,8.09,14]pentadecane (PubChem CID 52939469) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1R,3R,4R,8R,9R,14S)-4-[2-(furan-3-yl)ethyl]-3-methyl-5-methylidene-11,13,15-trioxatetracyclo[10.2.1.03,8.09,14]pentadecane.
| Compound Name | (1R,3R,4R,8R,9R,14S)-4-[2-(furan-3-yl)ethyl]-3-methyl-5-methylidene-11,13,15-trioxatetracyclo[10.2.1.03,8.09,14]pentadecane |
|---|---|
| PubChem CID | 52939469 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1R,3R,4R,8R,9R,14S)-4-[2-(furan-3-yl)ethyl]-3-methyl-5-methylidene-11,13,15-trioxatetracyclo[10.2.1.03,8.09,14]pentadecane |
| SMILES | C=C1CC[C@@H]2[C@@H]3COC4O[C@@H]3[C@@H](C[C@@]2(C)[C@@H]1CCc1ccoc1)O4 |
| InChI | InChI=1S/C20H26O4/c1-12-3-5-16-14-11-22-19-23-17(18(14)24-19)9-20(16,2)15(12)6-4-13-7-8-21-10-13/h7-8,10,14-19H,1,3-6,9,11H2,2H3/t14-,15+,16+,17+,18-,19?,20-/m0/s1 |
| InChIKey | XZBDCHWTCCNHSD-JYHCPPEWSA-N |
| XLogP | 3.92 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|