C24H36O2 — CID 102594190
(S)-[(1S,2R,5S,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-(furan-3-yl)methanol (PubChem CID 102594190) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (S)-[(1S,2R,5S,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-(furan-3-yl)methanol.
| Compound Name | (S)-[(1S,2R,5S,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 102594190 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (S)-[(1S,2R,5S,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-(furan-3-yl)methanol |
| SMILES | C=C(C)CCC[C@]1(C)CCC[C@@H]2C1=CC[C@@H](C)[C@]2(C)[C@H](O)c1ccoc1 |
| InChI | InChI=1S/C24H36O2/c1-17(2)8-6-13-23(4)14-7-9-21-20(23)11-10-18(3)24(21,5)22(25)19-12-15-26-16-19/h11-12,15-16,18,21-22,25H,1,6-10,13-14H2,2-5H3/t18-,21-,22-,23-,24+/m1/s1 |
| InChIKey | PNDBZHWLBMYSLH-JXIQEMPDSA-N |
| XLogP | 6.84 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|