C15H24 — CID 11458376
(6S)-1-ethenyl-6-methyl-6-(4-methylpent-4-enyl)cyclohexene (PubChem CID 11458376) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (6S)-1-ethenyl-6-methyl-6-(4-methylpent-4-enyl)cyclohexene.
| Compound Name | (6S)-1-ethenyl-6-methyl-6-(4-methylpent-4-enyl)cyclohexene |
|---|---|
| PubChem CID | 11458376 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (6S)-1-ethenyl-6-methyl-6-(4-methylpent-4-enyl)cyclohexene |
| SMILES | C=CC1=CCCC[C@@]1(C)CCCC(=C)C |
| InChI | InChI=1S/C15H24/c1-5-14-10-6-7-11-15(14,4)12-8-9-13(2)3/h5,10H,1-2,6-9,11-12H2,3-4H3/t15-/m0/s1 |
| InChIKey | IVAOTBXXXUFSSE-HNNXBMFYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|