C25H40O2Si — CID 11269593
tert-butyl-dimethyl-[1-[(6S)-6-methyl-6-(3-phenylmethoxypropyl)cyclohexen-1-yl]ethenoxy]silane (PubChem CID 11269593) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-[(6S)-6-methyl-6-(3-phenylmethoxypropyl)cyclohexen-1-yl]ethenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-[(6S)-6-methyl-6-(3-phenylmethoxypropyl)cyclohexen-1-yl]ethenoxy]silane |
|---|---|
| PubChem CID | 11269593 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | tert-butyl-dimethyl-[1-[(6S)-6-methyl-6-(3-phenylmethoxypropyl)cyclohexen-1-yl]ethenoxy]silane |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C1=CCCC[C@@]1(C)CCCOCc1ccccc1 |
| InChI | InChI=1S/C25H40O2Si/c1-21(27-28(6,7)24(2,3)4)23-16-11-12-17-25(23,5)18-13-19-26-20-22-14-9-8-10-15-22/h8-10,14-16H,1,11-13,17-20H2,2-7H3/t25-/m0/s1 |
| InChIKey | UZSYJFAJWRMMNB-VWLOTQADSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|