C21H24O3 — CID 11846077
(4S)-4,6-dimethyl-4-(3-phenylmethoxypropyl)-3H-chromen-2-one (PubChem CID 11846077) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4S)-4,6-dimethyl-4-(3-phenylmethoxypropyl)-3H-chromen-2-one.
| Compound Name | (4S)-4,6-dimethyl-4-(3-phenylmethoxypropyl)-3H-chromen-2-one |
|---|---|
| PubChem CID | 11846077 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (4S)-4,6-dimethyl-4-(3-phenylmethoxypropyl)-3H-chromen-2-one |
| SMILES | Cc1ccc2c(c1)[C@@](C)(CCCOCc1ccccc1)CC(=O)O2 |
| InChI | InChI=1S/C21H24O3/c1-16-9-10-19-18(13-16)21(2,14-20(22)24-19)11-6-12-23-15-17-7-4-3-5-8-17/h3-5,7-10,13H,6,11-12,14-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | PDLUOYUNRPTKAW-NRFANRHFSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|