C17H26O4 — CID 10968408
[(4R,5S)-2,2,5-trimethyl-5-(3-phenylmethoxypropyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 10968408) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(4R,5S)-2,2,5-trimethyl-5-(3-phenylmethoxypropyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-2,2,5-trimethyl-5-(3-phenylmethoxypropyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10968408 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(4R,5S)-2,2,5-trimethyl-5-(3-phenylmethoxypropyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@H](CO)[C@](C)(CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C17H26O4/c1-16(2)20-15(12-18)17(3,21-16)10-7-11-19-13-14-8-5-4-6-9-14/h4-6,8-9,15,18H,7,10-13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | MEBHEDSWFVOQHZ-WBVHZDCISA-N |
| XLogP | 2.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|