C16H24O6 — CID 10710231
(2R,3R,5R)-2-(hydroxymethyl)-5-methoxy-3-(2-phenylmethoxyethoxymethyl)oxolan-3-ol (PubChem CID 10710231) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (2R,3R,5R)-2-(hydroxymethyl)-5-methoxy-3-(2-phenylmethoxyethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-(hydroxymethyl)-5-methoxy-3-(2-phenylmethoxyethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10710231 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (2R,3R,5R)-2-(hydroxymethyl)-5-methoxy-3-(2-phenylmethoxyethoxymethyl)oxolan-3-ol |
| SMILES | CO[C@H]1C[C@@](O)(COCCOCc2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H24O6/c1-19-15-9-16(18,14(10-17)22-15)12-21-8-7-20-11-13-5-3-2-4-6-13/h2-6,14-15,17-18H,7-12H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | VZVSIMQDJGQWBY-BZUAXINKSA-N |
| XLogP | 0.70 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|