C23H30O3 — CID 15473516
[(1S,2S)-2-methyl-4,4-bis(phenylmethoxymethyl)cyclopentyl]methanol (PubChem CID 15473516) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(1S,2S)-2-methyl-4,4-bis(phenylmethoxymethyl)cyclopentyl]methanol.
| Compound Name | [(1S,2S)-2-methyl-4,4-bis(phenylmethoxymethyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 15473516 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(1S,2S)-2-methyl-4,4-bis(phenylmethoxymethyl)cyclopentyl]methanol |
| SMILES | C[C@H]1CC(COCc2ccccc2)(COCc2ccccc2)C[C@@H]1CO |
| InChI | InChI=1S/C23H30O3/c1-19-12-23(13-22(19)14-24,17-25-15-20-8-4-2-5-9-20)18-26-16-21-10-6-3-7-11-21/h2-11,19,22,24H,12-18H2,1H3/t19-,22+/m0/s1 |
| InChIKey | QPMWUSYHLKIMQL-SIKLNZKXSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |