C27H36O2Si — CID 177414108
[(E)-2-[(1S,5S)-3,3-bis(phenylmethoxymethyl)-1-bicyclo[3.1.0]hexanyl]ethenyl]-trimethylsilane (PubChem CID 177414108) has the molecular formula C27H36O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is [(E)-2-[(1S,5S)-3,3-bis(phenylmethoxymethyl)-1-bicyclo[3.1.0]hexanyl]ethenyl]-trimethylsilane.
| Compound Name | [(E)-2-[(1S,5S)-3,3-bis(phenylmethoxymethyl)-1-bicyclo[3.1.0]hexanyl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177414108 |
| Molecular Formula | C27H36O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(E)-2-[(1S,5S)-3,3-bis(phenylmethoxymethyl)-1-bicyclo[3.1.0]hexanyl]ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/[C@]12C[C@H]1CC(COCc1ccccc1)(COCc1ccccc1)C2 |
| InChI | InChI=1S/C27H36O2Si/c1-30(2,3)15-14-27-17-25(27)16-26(20-27,21-28-18-23-10-6-4-7-11-23)22-29-19-24-12-8-5-9-13-24/h4-15,25H,16-22H2,1-3H3/b15-14+/t25-,27-/m1/s1 |
| InChIKey | YZSQPUDSUXSHLF-BFRVEMNMSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|