C17H23NO3 — CID 11460449
(6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxane-4-carbonitrile (PubChem CID 11460449) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxane-4-carbonitrile.
| Compound Name | (6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 11460449 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxane-4-carbonitrile |
| SMILES | CC1(C)OC(C#N)C[C@H](CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C17H23NO3/c1-17(2)20-15(11-16(12-18)21-17)9-6-10-19-13-14-7-4-3-5-8-14/h3-5,7-8,15-16H,6,9-11,13H2,1-2H3/t15-,16?/m0/s1 |
| InChIKey | PDFIFRNIVOLLCB-VYRBHSGPSA-N |
| XLogP | 3.42 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|