C25H33IN2O5 — CID 11114467
(4R,6S)-6-[[(4R,6S)-4-cyano-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-4-(2-phenylmethoxyethyl)-1,3-dioxane-4-carbonitrile (PubChem CID 11114467) has the molecular formula C25H33IN2O5 and a molecular weight of 568.45 g/mol. Its IUPAC name is (4R,6S)-6-[[(4R,6S)-4-cyano-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-4-(2-phenylmethoxyethyl)-1,3-dioxane-4-carbonitrile.
| Compound Name | (4R,6S)-6-[[(4R,6S)-4-cyano-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-4-(2-phenylmethoxyethyl)-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 11114467 |
| Molecular Formula | C25H33IN2O5 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | (4R,6S)-6-[[(4R,6S)-4-cyano-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-4-(2-phenylmethoxyethyl)-1,3-dioxane-4-carbonitrile |
| SMILES | CC1(C)O[C@H](CI)C[C@@](C#N)(C[C@@H]2C[C@@](C#N)(CCOCc3ccccc3)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C25H33IN2O5/c1-22(2)30-20(13-25(18-28)14-21(15-26)31-23(3,4)33-25)12-24(17-27,32-22)10-11-29-16-19-8-6-5-7-9-19/h5-9,20-21H,10-16H2,1-4H3/t20-,21-,24+,25+/m0/s1 |
| InChIKey | CLFOIXWNWZIGSW-KXTAGPOFSA-N |
| XLogP | 5.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|