C33H58O3Sn — CID 11238986
tributyl-[(E)-5-[(4R,6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]stannane (PubChem CID 11238986) has the molecular formula C33H58O3Sn and a molecular weight of 621.54 g/mol. Its IUPAC name is tributyl-[(E)-5-[(4R,6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]stannane.
| Compound Name | tributyl-[(E)-5-[(4R,6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]stannane |
|---|---|
| PubChem CID | 11238986 |
| Molecular Formula | C33H58O3Sn |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | tributyl-[(E)-5-[(4R,6S)-2,2-dimethyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]stannane |
| SMILES | CCCC[Sn](/C=C/CCC[C@@H]1C[C@H](CCCOCc2ccccc2)OC(C)(C)O1)(CCCC)CCCC |
| InChI | InChI=1S/C21H31O3.3C4H9.Sn/c1-4-5-7-13-19-16-20(24-21(2,3)23-19)14-10-15-22-17-18-11-8-6-9-12-18;3*1-3-4-2;/h1,4,6,8-9,11-12,19-20H,5,7,10,13-17H2,2-3H3;3*1,3-4H2,2H3;/t19-,20+;;;;/m1..../s1 |
| InChIKey | ITVCNHFDLJLVJS-MTWMUPKRSA-N |
| XLogP | 10.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|