C30H36O5 — CID 24854395
(R)-[(4R,5R,6R)-2,2-dimethyl-5-phenylmethoxy-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]-phenylmethanol (PubChem CID 24854395) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is (R)-[(4R,5R,6R)-2,2-dimethyl-5-phenylmethoxy-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]-phenylmethanol.
| Compound Name | (R)-[(4R,5R,6R)-2,2-dimethyl-5-phenylmethoxy-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 24854395 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (R)-[(4R,5R,6R)-2,2-dimethyl-5-phenylmethoxy-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]-phenylmethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)c2ccccc2)[C@H](OCc2ccccc2)[C@@H](CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C30H36O5/c1-30(2)34-26(19-12-20-32-21-23-13-6-3-7-14-23)28(33-22-24-15-8-4-9-16-24)29(35-30)27(31)25-17-10-5-11-18-25/h3-11,13-18,26-29,31H,12,19-22H2,1-2H3/t26-,27-,28-,29-/m1/s1 |
| InChIKey | DPSNCLVCDIWTCO-CXDXLJMYSA-N |
| XLogP | 5.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|