C21H33NO5 — CID 51041885
(4R,5S)-5-[(1R)-1-hydroxy-6-phenylmethoxyhexyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide (PubChem CID 51041885) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is (4R,5S)-5-[(1R)-1-hydroxy-6-phenylmethoxyhexyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide.
| Compound Name | (4R,5S)-5-[(1R)-1-hydroxy-6-phenylmethoxyhexyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 51041885 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (4R,5S)-5-[(1R)-1-hydroxy-6-phenylmethoxyhexyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1OC(C)(C)O[C@H]1[C@H](O)CCCCCOCc1ccccc1 |
| InChI | InChI=1S/C21H33NO5/c1-21(2)26-18(19(27-21)20(24)22(3)4)17(23)13-9-6-10-14-25-15-16-11-7-5-8-12-16/h5,7-8,11-12,17-19,23H,6,9-10,13-15H2,1-4H3/t17-,18+,19-/m1/s1 |
| InChIKey | GLMBHPADUWXWMV-CEXWTWQISA-N |
| XLogP | 2.73 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|