C25H41NO4Si — CID 11155091
(6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentan-2-yl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile (PubChem CID 11155091) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is (6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentan-2-yl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentan-2-yl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 11155091 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentan-2-yl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
| SMILES | C[C@@H]([C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C)[C@H]1CC(C#N)OC(C)(C)O1 |
| InChI | InChI=1S/C25H41NO4Si/c1-19(23-16-21(17-26)28-25(5,6)29-23)22(30-31(7,8)24(2,3)4)14-15-27-18-20-12-10-9-11-13-20/h9-13,19,21-23H,14-16,18H2,1-8H3/t19-,21?,22-,23+/m0/s1 |
| InChIKey | BCFZBRBYUFNUPC-ZSJMHYJMSA-N |
| XLogP | 6.05 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|