C24H42O5Si — CID 53235768
(2S,3R,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methyl-7-(3-phenylmethoxypropyl)oxepan-3-ol (PubChem CID 53235768) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (2S,3R,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methyl-7-(3-phenylmethoxypropyl)oxepan-3-ol.
| Compound Name | (2S,3R,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methyl-7-(3-phenylmethoxypropyl)oxepan-3-ol |
|---|---|
| PubChem CID | 53235768 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2S,3R,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methyl-7-(3-phenylmethoxypropyl)oxepan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(C)CC[C@@H](O)[C@H](CO)O[C@@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C24H42O5Si/c1-23(2,3)30(5,6)29-24(4)15-14-20(26)21(17-25)28-22(24)13-10-16-27-18-19-11-8-7-9-12-19/h7-9,11-12,20-22,25-26H,10,13-18H2,1-6H3/t20-,21+,22-,24+/m1/s1 |
| InChIKey | FSMBPQYRHSHFJT-GBAAUQCPSA-N |
| XLogP | 4.66 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|