C32H46O5Si — CID 46702204
2-[(2S,3R,6S,7R)-6-methyl-6-phenylmethoxy-7-(3-phenylmethoxypropyl)-3-triethylsilyloxy-3,7-dihydro-2H-oxepin-2-yl]acetaldehyde (PubChem CID 46702204) has the molecular formula C32H46O5Si and a molecular weight of 538.80 g/mol. Its IUPAC name is 2-[(2S,3R,6S,7R)-6-methyl-6-phenylmethoxy-7-(3-phenylmethoxypropyl)-3-triethylsilyloxy-3,7-dihydro-2H-oxepin-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,6S,7R)-6-methyl-6-phenylmethoxy-7-(3-phenylmethoxypropyl)-3-triethylsilyloxy-3,7-dihydro-2H-oxepin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 46702204 |
| Molecular Formula | C32H46O5Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2-[(2S,3R,6S,7R)-6-methyl-6-phenylmethoxy-7-(3-phenylmethoxypropyl)-3-triethylsilyloxy-3,7-dihydro-2H-oxepin-2-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C[C@](C)(OCc2ccccc2)[C@@H](CCCOCc2ccccc2)O[C@H]1CC=O |
| InChI | InChI=1S/C32H46O5Si/c1-5-38(6-2,7-3)37-30-20-22-32(4,35-26-28-17-12-9-13-18-28)31(36-29(30)21-23-33)19-14-24-34-25-27-15-10-8-11-16-27/h8-13,15-18,20,22-23,29-31H,5-7,14,19,21,24-26H2,1-4H3/t29-,30+,31+,32-/m0/s1 |
| InChIKey | MYZZHDBNNFDWMH-BVEPWEIPSA-N |
| XLogP | 7.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|