C28H50O4Si2 — CID 46209621
triethyl-[(3S,4S,5R,6S)-5-methyl-2-methylidene-6-(2-phenylmethoxyethyl)-3-triethylsilyloxyoxan-4-yl]oxysilane (PubChem CID 46209621) has the molecular formula C28H50O4Si2 and a molecular weight of 506.88 g/mol. Its IUPAC name is triethyl-[(3S,4S,5R,6S)-5-methyl-2-methylidene-6-(2-phenylmethoxyethyl)-3-triethylsilyloxyoxan-4-yl]oxysilane.
| Compound Name | triethyl-[(3S,4S,5R,6S)-5-methyl-2-methylidene-6-(2-phenylmethoxyethyl)-3-triethylsilyloxyoxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 46209621 |
| Molecular Formula | C28H50O4Si2 |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | triethyl-[(3S,4S,5R,6S)-5-methyl-2-methylidene-6-(2-phenylmethoxyethyl)-3-triethylsilyloxyoxan-4-yl]oxysilane |
| SMILES | C=C1O[C@@H](CCOCc2ccccc2)[C@@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H50O4Si2/c1-9-33(10-2,11-3)31-27-23(7)26(20-21-29-22-25-18-16-15-17-19-25)30-24(8)28(27)32-34(12-4,13-5)14-6/h15-19,23,26-28H,8-14,20-22H2,1-7H3/t23-,26+,27+,28-/m1/s1 |
| InChIKey | CMYNLLZIFORGRU-HBMTYJCASA-N |
| XLogP | 7.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|