C33H44O10Si — CID 85384658
7-hydroxy-4-(phenylmethoxymethyl)-6-[[2-(phenylmethoxymethyl)-4-triethylsilyloxy-3,4-dihydro-2H-pyran-3-yl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one (PubChem CID 85384658) has the molecular formula C33H44O10Si and a molecular weight of 628.79 g/mol. Its IUPAC name is 7-hydroxy-4-(phenylmethoxymethyl)-6-[[2-(phenylmethoxymethyl)-4-triethylsilyloxy-3,4-dihydro-2H-pyran-3-yl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one.
| Compound Name | 7-hydroxy-4-(phenylmethoxymethyl)-6-[[2-(phenylmethoxymethyl)-4-triethylsilyloxy-3,4-dihydro-2H-pyran-3-yl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
|---|---|
| PubChem CID | 85384658 |
| Molecular Formula | C33H44O10Si |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 7-hydroxy-4-(phenylmethoxymethyl)-6-[[2-(phenylmethoxymethyl)-4-triethylsilyloxy-3,4-dihydro-2H-pyran-3-yl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
| SMILES | CC[Si](CC)(CC)OC1C=COC(COCc2ccccc2)C1OC1OC(COCc2ccccc2)C2OC(=O)OC2C1O |
| InChI | InChI=1S/C33H44O10Si/c1-4-44(5-2,6-3)43-25-17-18-38-26(21-36-19-23-13-9-7-10-14-23)29(25)40-32-28(34)31-30(41-33(35)42-31)27(39-32)22-37-20-24-15-11-8-12-16-24/h7-18,25-32,34H,4-6,19-22H2,1-3H3 |
| InChIKey | DFMAURPXFZKLEE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|