C47H50O9 — CID 102122335
[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl]oxy]oxan-2-yl]methanol (PubChem CID 102122335) has the molecular formula C47H50O9 and a molecular weight of 758.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl]oxy]oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl]oxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 102122335 |
| Molecular Formula | C47H50O9 |
| Molecular Weight | 758.91 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl]oxy]oxan-2-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](OCc3ccccc3)C=CO[C@@H]2COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H50O9/c48-28-41-44(52-31-37-20-10-3-11-21-37)45(53-32-38-22-12-4-13-23-38)46(54-33-39-24-14-5-15-25-39)47(55-41)56-43-40(51-30-36-18-8-2-9-19-36)26-27-50-42(43)34-49-29-35-16-6-1-7-17-35/h1-27,40-48H,28-34H2/t40-,41-,42-,43+,44-,45+,46-,47+/m1/s1 |
| InChIKey | ATWYKTSFCDQFMS-CZUVKHMMSA-N |
| XLogP | 7.56 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.91 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |