C26H44O4Si — CID 99772665
(5R,7R,9S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-(phenylmethoxymethyl)-1-oxaspiro[4.5]decan-7-ol (PubChem CID 99772665) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (5R,7R,9S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-(phenylmethoxymethyl)-1-oxaspiro[4.5]decan-7-ol.
| Compound Name | (5R,7R,9S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-(phenylmethoxymethyl)-1-oxaspiro[4.5]decan-7-ol |
|---|---|
| PubChem CID | 99772665 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (5R,7R,9S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-(phenylmethoxymethyl)-1-oxaspiro[4.5]decan-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@]1(O)C[C@H](COCc2ccccc2)C[C@]2(CCCO2)C1 |
| InChI | InChI=1S/C26H44O4Si/c1-24(2,3)31(4,5)30-16-9-13-25(27)17-23(18-26(21-25)14-10-15-29-26)20-28-19-22-11-7-6-8-12-22/h6-8,11-12,23,27H,9-10,13-21H2,1-5H3/t23-,25+,26+/m0/s1 |
| InChIKey | FLHSZWOWDZYQDN-SKBVVQJISA-N |
| XLogP | 6.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|