C20H28O3 — CID 10615361
(5S,7R,9R)-9-(phenylmethoxymethyl)-7-prop-2-enyl-1-oxaspiro[4.5]decan-7-ol (PubChem CID 10615361) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (5S,7R,9R)-9-(phenylmethoxymethyl)-7-prop-2-enyl-1-oxaspiro[4.5]decan-7-ol.
| Compound Name | (5S,7R,9R)-9-(phenylmethoxymethyl)-7-prop-2-enyl-1-oxaspiro[4.5]decan-7-ol |
|---|---|
| PubChem CID | 10615361 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (5S,7R,9R)-9-(phenylmethoxymethyl)-7-prop-2-enyl-1-oxaspiro[4.5]decan-7-ol |
| SMILES | C=CC[C@@]1(O)C[C@@H](COCc2ccccc2)C[C@@]2(CCCO2)C1 |
| InChI | InChI=1S/C20H28O3/c1-2-9-19(21)12-18(13-20(16-19)10-6-11-23-20)15-22-14-17-7-4-3-5-8-17/h2-5,7-8,18,21H,1,6,9-16H2/t18-,19-,20+/m1/s1 |
| InChIKey | ADUHOHYAECDKPY-AQNXPRMDSA-N |
| XLogP | 3.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|